C19H34N4O8S — CID 7127882
(1S,3S,4R,5R)-N-[(2S)-1-amino-4-methylsulfonyl-1-oxobutan-2-yl]-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 7127882) has the molecular formula C19H34N4O8S and a molecular weight of 478.57 g/mol. Its IUPAC name is (1S,3S,4R,5R)-N-[(2S)-1-amino-4-methylsulfonyl-1-oxobutan-2-yl]-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-N-[(2S)-1-amino-4-methylsulfonyl-1-oxobutan-2-yl]-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7127882 |
| Molecular Formula | C19H34N4O8S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (1S,3S,4R,5R)-N-[(2S)-1-amino-4-methylsulfonyl-1-oxobutan-2-yl]-3-(cyclohexylcarbamoylamino)-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | CS(=O)(=O)CC[C@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)NC2CCCCC2)C1)C(N)=O |
| InChI | InChI=1S/C19H34N4O8S/c1-32(30,31)8-7-12(16(20)26)22-17(27)19(29)9-13(15(25)14(24)10-19)23-18(28)21-11-5-3-2-4-6-11/h11-15,24-25,29H,2-10H2,1H3,(H2,20,26)(H,22,27)(H2,21,23,28)/t12-,13-,14+,15+,19-/m0/s1 |
| InChIKey | WBXCGHMJJUUYJD-IDJSLIICSA-N |
| XLogP | -2.36 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |