C21H31N3O8S — CID 7134480
(1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[[2-(benzenesulfonyl)acetyl]amino]-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 7134480) has the molecular formula C21H31N3O8S and a molecular weight of 485.56 g/mol. Its IUPAC name is (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[[2-(benzenesulfonyl)acetyl]amino]-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[[2-(benzenesulfonyl)acetyl]amino]-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134480 |
| Molecular Formula | C21H31N3O8S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[[2-(benzenesulfonyl)acetyl]amino]-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)CS(=O)(=O)c2ccccc2)C1)C(N)=O |
| InChI | InChI=1S/C21H31N3O8S/c1-12(2)8-14(19(22)28)24-20(29)21(30)9-15(18(27)16(25)10-21)23-17(26)11-33(31,32)13-6-4-3-5-7-13/h3-7,12,14-16,18,25,27,30H,8-11H2,1-2H3,(H2,22,28)(H,23,26)(H,24,29)/t14-,15+,16-,18-,21+/m1/s1 |
| InChIKey | OJEJIXUWEBURDB-JVKMFMNGSA-N |
| XLogP | -1.79 |
| TPSA | 196.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |