C20H29FN4O6 — CID 7050195
(1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[(3-fluorophenyl)carbamoylamino]-1,4,5-trihydroxycyclohexane-1-carboxamide (PubChem CID 7050195) has the molecular formula C20H29FN4O6 and a molecular weight of 440.47 g/mol. Its IUPAC name is (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[(3-fluorophenyl)carbamoylamino]-1,4,5-trihydroxycyclohexane-1-carboxamide.
| Compound Name | (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[(3-fluorophenyl)carbamoylamino]-1,4,5-trihydroxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7050195 |
| Molecular Formula | C20H29FN4O6 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (1S,3S,4R,5R)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-3-[(3-fluorophenyl)carbamoylamino]-1,4,5-trihydroxycyclohexane-1-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2cccc(F)c2)C1)C(N)=O |
| InChI | InChI=1S/C20H29FN4O6/c1-10(2)6-13(17(22)28)24-18(29)20(31)8-14(16(27)15(26)9-20)25-19(30)23-12-5-3-4-11(21)7-12/h3-5,7,10,13-16,26-27,31H,6,8-9H2,1-2H3,(H2,22,28)(H,24,29)(H2,23,25,30)/t13-,14+,15-,16-,20+/m1/s1 |
| InChIKey | QFUPAOXFZRXLHB-YFSSQWDJSA-N |
| XLogP | -0.42 |
| TPSA | 174.01 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |