C9H18N4O3 — CID 118657365
(2S)-2-(3-aminopropanoylamino)-3-imidazolidin-4-ylpropanoic acid (PubChem CID 118657365) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is (2S)-2-(3-aminopropanoylamino)-3-imidazolidin-4-ylpropanoic acid.
| Compound Name | (2S)-2-(3-aminopropanoylamino)-3-imidazolidin-4-ylpropanoic acid |
|---|---|
| PubChem CID | 118657365 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (2S)-2-(3-aminopropanoylamino)-3-imidazolidin-4-ylpropanoic acid |
| SMILES | NCCC(=O)N[C@@H](CC1CNCN1)C(=O)O |
| InChI | InChI=1S/C9H18N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h6-7,11-12H,1-5,10H2,(H,13,14)(H,15,16)/t6?,7-/m0/s1 |
| InChIKey | NIXKPYUUSMVZRA-MLWJPKLSSA-N |
| XLogP | -2.19 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |