C33H36ClFN6O3S — CID 118658994
(2S)-2-[[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[6-(piperidin-3-ylamino)-3-pyridinyl]amino]quinolin-3-yl]-cyclopropylamino]-4-methylsulfanylbutanoic acid (PubChem CID 118658994) has the molecular formula C33H36ClFN6O3S and a molecular weight of 651.21 g/mol. Its IUPAC name is (2S)-2-[[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[6-(piperidin-3-ylamino)-3-pyridinyl]amino]quinolin-3-yl]-cyclopropylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[6-(piperidin-3-ylamino)-3-pyridinyl]amino]quinolin-3-yl]-cyclopropylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 118658994 |
| Molecular Formula | C33H36ClFN6O3S |
| Molecular Weight | 651.21 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | (2S)-2-[[6-(3-chloro-5-fluoro-4-hydroxyphenyl)-4-[[6-(piperidin-3-ylamino)-3-pyridinyl]amino]quinolin-3-yl]-cyclopropylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N(c1cnc2ccc(-c3cc(F)c(O)c(Cl)c3)cc2c1Nc1ccc(NC2CCCNC2)nc1)C1CC1 |
| InChI | InChI=1S/C33H36ClFN6O3S/c1-45-12-10-28(33(43)44)41(23-6-7-23)29-18-37-27-8-4-19(20-14-25(34)32(42)26(35)15-20)13-24(27)31(29)40-22-5-9-30(38-17-22)39-21-3-2-11-36-16-21/h4-5,8-9,13-15,17-18,21,23,28,36,42H,2-3,6-7,10-12,16H2,1H3,(H,37,40)(H,38,39)(H,43,44)/t21?,28-/m0/s1 |
| InChIKey | ULRKHLGCGJOUKG-QVWGJOIVSA-N |
| XLogP | 6.88 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.21 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |