C23H21N5O — CID 118660637
[1-amino-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]-(azetidin-1-yl)methanone (PubChem CID 118660637) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is [1-amino-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]-(azetidin-1-yl)methanone.
| Compound Name | [1-amino-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]-(azetidin-1-yl)methanone |
|---|---|
| PubChem CID | 118660637 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [1-amino-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinolin-6-yl]-(azetidin-1-yl)methanone |
| SMILES | Cn1cc(-c2ccc(-c3cnc(N)c4ccc(C(=O)N5CCC5)cc34)cc2)cn1 |
| InChI | InChI=1S/C23H21N5O/c1-27-14-18(12-26-27)15-3-5-16(6-4-15)21-13-25-22(24)19-8-7-17(11-20(19)21)23(29)28-9-2-10-28/h3-8,11-14H,2,9-10H2,1H3,(H2,24,25) |
| InChIKey | PKVBYJSJCFQYQW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |