C25H24N4O — CID 137490340
[6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanone (PubChem CID 137490340) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 137490340 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanone |
| SMILES | Cn1cc(-c2ccc(-c3ccc4nccc(C(=O)N5CCCCC5)c4c3)cc2)cn1 |
| InChI | InChI=1S/C25H24N4O/c1-28-17-21(16-27-28)19-7-5-18(6-8-19)20-9-10-24-23(15-20)22(11-12-26-24)25(30)29-13-3-2-4-14-29/h5-12,15-17H,2-4,13-14H2,1H3 |
| InChIKey | BZUFBYZIWYZJCX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |