C25H25N5 — CID 137490343
[6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanimine (PubChem CID 137490343) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanimine.
| Compound Name | [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 137490343 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [6-[4-(1-methylpyrazol-4-yl)phenyl]quinolin-4-yl]-piperidin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1ccnc2ccc(-c3ccc(-c4cnn(C)c4)cc3)cc12)N1CCCCC1 |
| InChI | InChI=1S/C25H25N5/c1-29-17-21(16-28-29)19-7-5-18(6-8-19)20-9-10-24-23(15-20)22(11-12-27-24)25(26)30-13-3-2-4-14-30/h5-12,15-17,26H,2-4,13-14H2,1H3/b26-25- |
| InChIKey | AFWUVFFXCMCKAR-QPLCGJKRSA-N |
| XLogP | 5.11 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|