C21H32N2O2S — CID 118662064
[8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-(oxan-4-yl)methanone (PubChem CID 118662064) has the molecular formula C21H32N2O2S and a molecular weight of 376.57 g/mol. Its IUPAC name is [8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-(oxan-4-yl)methanone.
| Compound Name | [8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 118662064 |
| Molecular Formula | C21H32N2O2S |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-(oxan-4-yl)methanone |
| SMILES | CN(C)C1(c2cccs2)CCC2(CCN(C(=O)C3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C21H32N2O2S/c1-22(2)21(18-4-3-15-26-18)9-7-20(8-10-21)11-12-23(16-20)19(24)17-5-13-25-14-6-17/h3-4,15,17H,5-14,16H2,1-2H3 |
| InChIKey | FDFZSDRUGZTOAN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |