C22H35N3OS — CID 118666329
1-[8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-2-piperidin-4-ylethanone (PubChem CID 118666329) has the molecular formula C22H35N3OS and a molecular weight of 389.61 g/mol. Its IUPAC name is 1-[8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-2-piperidin-4-ylethanone.
| Compound Name | 1-[8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-2-piperidin-4-ylethanone |
|---|---|
| PubChem CID | 118666329 |
| Molecular Formula | C22H35N3OS |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 1-[8-(dimethylamino)-8-thiophen-2-yl-2-azaspiro[4.5]decan-2-yl]-2-piperidin-4-ylethanone |
| SMILES | CN(C)C1(c2cccs2)CCC2(CCN(C(=O)CC3CCNCC3)C2)CC1 |
| InChI | InChI=1S/C22H35N3OS/c1-24(2)22(19-4-3-15-27-19)9-7-21(8-10-22)11-14-25(17-21)20(26)16-18-5-12-23-13-6-18/h3-4,15,18,23H,5-14,16-17H2,1-2H3 |
| InChIKey | YCQHQXSXCDIUIF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |