C26H35N3O2S — CID 11866482
(2S)-2-[(4S,4aS,5S,6S,8aS)-2-anilino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 11866482) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6S,8aS)-2-anilino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2S)-2-[(4S,4aS,5S,6S,8aS)-2-anilino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 11866482 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6S,8aS)-2-anilino-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCCC1)[C@@H]1CC[C@@]2(C)Cc3sc(Nc4ccccc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C26H35N3O2S/c1-16(24(31)29-13-7-8-14-29)19-11-12-26(3)15-20-22(17(2)21(26)23(19)30)28-25(32-20)27-18-9-5-4-6-10-18/h4-6,9-10,16-17,19,21,23,30H,7-8,11-15H2,1-3H3,(H,27,28)/t16-,17-,19-,21+,23-,26-/m0/s1 |
| InChIKey | CASUEGMMSOOFES-RSLISJKCSA-N |
| XLogP | 5.20 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |