C27H37N3O3S — CID 162813727
(2S)-2-[(4R,4aS,5S,6S,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 162813727) has the molecular formula C27H37N3O3S and a molecular weight of 483.68 g/mol. Its IUPAC name is (2S)-2-[(4R,4aS,5S,6S,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | (2S)-2-[(4R,4aS,5S,6S,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 162813727 |
| Molecular Formula | C27H37N3O3S |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | (2S)-2-[(4R,4aS,5S,6S,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | C[C@H](C(=O)N1CCOCC1)[C@@H]1CC[C@]2(C)Cc3sc(NCc4ccccc4)nc3[C@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C27H37N3O3S/c1-17(25(32)30-11-13-33-14-12-30)20-9-10-27(3)15-21-23(18(2)22(27)24(20)31)29-26(34-21)28-16-19-7-5-4-6-8-19/h4-8,17-18,20,22,24,31H,9-16H2,1-3H3,(H,28,29)/t17-,18+,20-,22+,24-,27+/m0/s1 |
| InChIKey | KOIFXRKVUBRIBI-FPBKQGHRSA-N |
| XLogP | 4.30 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |