C27H35N3O2S — CID 3428887
2-[2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-ynylpropanamide (PubChem CID 3428887) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is 2-[2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-ynylpropanamide.
| Compound Name | 2-[2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 3428887 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-ynylpropanamide |
| SMILES | C#CCN(C)C(=O)C(C)C1CCC2(C)Cc3sc(NCc4ccccc4)nc3C(C)C2C1O |
| InChI | InChI=1S/C27H35N3O2S/c1-6-14-30(5)25(32)17(2)20-12-13-27(4)15-21-23(18(3)22(27)24(20)31)29-26(33-21)28-16-19-10-8-7-9-11-19/h1,7-11,17-18,20,22,24,31H,12-16H2,2-5H3,(H,28,29) |
| InChIKey | UJFFHBMGIRDCAH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|