C25H44N4O2S — CID 3801914
2-[2-(butylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-[2-(dimethylamino)ethyl]-N-methylpropanamide (PubChem CID 3801914) has the molecular formula C25H44N4O2S and a molecular weight of 464.72 g/mol. Its IUPAC name is 2-[2-(butylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-[2-(dimethylamino)ethyl]-N-methylpropanamide.
| Compound Name | 2-[2-(butylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-[2-(dimethylamino)ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 3801914 |
| Molecular Formula | C25H44N4O2S |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | 2-[2-(butylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-[2-(dimethylamino)ethyl]-N-methylpropanamide |
| SMILES | CCCCNc1nc2c(s1)CC1(C)CCC(C(C)C(=O)N(C)CCN(C)C)C(O)C1C2C |
| InChI | InChI=1S/C25H44N4O2S/c1-8-9-12-26-24-27-21-17(3)20-22(30)18(10-11-25(20,4)15-19(21)32-24)16(2)23(31)29(7)14-13-28(5)6/h16-18,20,22,30H,8-15H2,1-7H3,(H,26,27) |
| InChIKey | UMPUODFYXRUEIV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|