C27H39N3O2S — CID 162809576
(2S)-2-[(4S,4aS,5S,6R,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide (PubChem CID 162809576) has the molecular formula C27H39N3O2S and a molecular weight of 469.70 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6R,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,6R,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 162809576 |
| Molecular Formula | C27H39N3O2S |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6R,8aR)-2-(benzylamino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)[C@@H](C)[C@H]1CC[C@]2(C)Cc3sc(NCc4ccccc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C27H39N3O2S/c1-6-30(7-2)25(32)17(3)20-13-14-27(5)15-21-23(18(4)22(27)24(20)31)29-26(33-21)28-16-19-11-9-8-10-12-19/h8-12,17-18,20,22,24,31H,6-7,13-16H2,1-5H3,(H,28,29)/t17-,18-,20+,22+,24-,27+/m0/s1 |
| InChIKey | PTYHGPRKRJVNOI-KDBNAHRWSA-N |
| XLogP | 5.31 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |