C25H36N4O2S — CID 3827031
N,N-diethyl-2-[5-hydroxy-4,8a-dimethyl-2-(pyridin-3-ylamino)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide (PubChem CID 3827031) has the molecular formula C25H36N4O2S and a molecular weight of 456.66 g/mol. Its IUPAC name is N,N-diethyl-2-[5-hydroxy-4,8a-dimethyl-2-(pyridin-3-ylamino)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide.
| Compound Name | N,N-diethyl-2-[5-hydroxy-4,8a-dimethyl-2-(pyridin-3-ylamino)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
|---|---|
| PubChem CID | 3827031 |
| Molecular Formula | C25H36N4O2S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | N,N-diethyl-2-[5-hydroxy-4,8a-dimethyl-2-(pyridin-3-ylamino)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]propanamide |
| SMILES | CCN(CC)C(=O)C(C)C1CCC2(C)Cc3sc(Nc4cccnc4)nc3C(C)C2C1O |
| InChI | InChI=1S/C25H36N4O2S/c1-6-29(7-2)23(31)15(3)18-10-11-25(5)13-19-21(16(4)20(25)22(18)30)28-24(32-19)27-17-9-8-12-26-14-17/h8-9,12,14-16,18,20,22,30H,6-7,10-11,13H2,1-5H3,(H,27,28) |
| InChIKey | VRDFHGOUNOZXNO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |