C25H34FN3O3S — CID 45361309
(2S)-2-[(4S,4aS,5S,8aS)-2-(4-fluoroanilino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 45361309) has the molecular formula C25H34FN3O3S and a molecular weight of 475.63 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,8aS)-2-(4-fluoroanilino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,8aS)-2-(4-fluoroanilino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 45361309 |
| Molecular Formula | C25H34FN3O3S |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,8aS)-2-(4-fluoroanilino)-5-hydroxy-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)C1CC[C@@]2(C)Cc3sc(Nc4ccc(F)cc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C25H34FN3O3S/c1-14(23(31)27-11-12-32-4)18-9-10-25(3)13-19-21(15(2)20(25)22(18)30)29-24(33-19)28-17-7-5-16(26)6-8-17/h5-8,14-15,18,20,22,30H,9-13H2,1-4H3,(H,27,31)(H,28,29)/t14-,15-,18?,20+,22-,25-/m0/s1 |
| InChIKey | OIWBIWGVOQEUSJ-OVXADWHWSA-N |
| XLogP | 4.48 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|