C24H33N3O4S2 — CID 11866788
N-[(4S,4aS,5S,6S,8aR)-5-hydroxy-6-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-2-yl]thiophene-2-carboxamide (PubChem CID 11866788) has the molecular formula C24H33N3O4S2 and a molecular weight of 491.68 g/mol. Its IUPAC name is N-[(4S,4aS,5S,6S,8aR)-5-hydroxy-6-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(4S,4aS,5S,6S,8aR)-5-hydroxy-6-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11866788 |
| Molecular Formula | C24H33N3O4S2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[(4S,4aS,5S,6S,8aR)-5-hydroxy-6-[(2S)-1-(2-methoxyethylamino)-1-oxopropan-2-yl]-4,8a-dimethyl-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-2-yl]thiophene-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H](C)[C@@H]1CC[C@]2(C)Cc3sc(NC(=O)c4cccs4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C24H33N3O4S2/c1-13(21(29)25-9-10-31-4)15-7-8-24(3)12-17-19(14(2)18(24)20(15)28)26-23(33-17)27-22(30)16-6-5-11-32-16/h5-6,11,13-15,18,20,28H,7-10,12H2,1-4H3,(H,25,29)(H,26,27,30)/t13-,14-,15-,18+,20-,24+/m0/s1 |
| InChIKey | RBLVCBCPGDDHKU-LBXVNUDRSA-N |
| XLogP | 3.91 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|