C21H24N2O3S2 — CID 11866204
N-[(3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-2-oxo-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-8-yl]thiophene-2-carboxamide (PubChem CID 11866204) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[(3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-2-oxo-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-8-yl]thiophene-2-carboxamide.
| Compound Name | N-[(3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-2-oxo-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-8-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 11866204 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[(3S,3aS,5aS,10S,10aS,10bS)-3,5a,10-trimethyl-2-oxo-3,3a,4,5,6,10,10a,10b-octahydro-[1]benzofuro[7,6-f][1,3]benzothiazol-8-yl]thiophene-2-carboxamide |
| SMILES | C[C@@H]1C(=O)O[C@H]2[C@H]1CC[C@@]1(C)Cc3sc(NC(=O)c4cccs4)nc3[C@@H](C)[C@H]21 |
| InChI | InChI=1S/C21H24N2O3S2/c1-10-12-6-7-21(3)9-14-16(11(2)15(21)17(12)26-19(10)25)22-20(28-14)23-18(24)13-5-4-8-27-13/h4-5,8,10-12,15,17H,6-7,9H2,1-3H3,(H,22,23,24)/t10-,11-,12-,15+,17-,21-/m0/s1 |
| InChIKey | JLZNMYYUCJBSSU-GWDMFLPMSA-N |
| XLogP | 4.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |