C26H36N2O3S2 — CID 11866613
(2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-(phenylsulfanylmethyl)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 11866613) has the molecular formula C26H36N2O3S2 and a molecular weight of 488.72 g/mol. Its IUPAC name is (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-(phenylsulfanylmethyl)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-(phenylsulfanylmethyl)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 11866613 |
| Molecular Formula | C26H36N2O3S2 |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (2S)-2-[(4S,4aS,5S,6R,8aS)-5-hydroxy-4,8a-dimethyl-2-(phenylsulfanylmethyl)-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)[C@@H](C)[C@H]1CC[C@@]2(C)Cc3sc(CSc4ccccc4)nc3[C@@H](C)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C26H36N2O3S2/c1-16(25(30)27-12-13-31-4)19-10-11-26(3)14-20-23(17(2)22(26)24(19)29)28-21(33-20)15-32-18-8-6-5-7-9-18/h5-9,16-17,19,22,24,29H,10-15H2,1-4H3,(H,27,30)/t16-,17-,19+,22+,24-,26-/m0/s1 |
| InChIKey | WSESTZFJGXGMJU-QHCHOKFJSA-N |
| XLogP | 4.89 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|