About methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate
methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate (PubChem CID 118666490) has the molecular formula C15H20N2O4
and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate |
| PubChem CID | 118666490 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate |
| SMILES | COC(=O)NC1(c2ccccn2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20N2O4/c1-19-13(18)17-14(12-4-2-3-9-16-12)5-7-15(8-6-14)20-10-11-21-15/h2-4,9H,5-8,10-11H2,1H3,(H,17,18) |
| InChIKey | KDJLTJLQYHNGGV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate?
The IUPAC name of methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate (CID 118666490) is methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate.
What is the SMILES notation for methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate?
The canonical SMILES for methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate is COC(=O)NC1(c2ccccn2)CCC2(CC1)OCCO2.
What is the InChIKey of methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate?
The InChIKey is KDJLTJLQYHNGGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O4/c1-19-13(18)17-14(12-4-2-3-9-16-12)5-7-15(8-6-14)20-10-11-21-15/h2-4,9H,5-8,10-11H2,1H3,(H,17,18).
What are the key properties of methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate?
methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate has a molecular weight of 292.33 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(8-pyridin-2-yl-1,4-dioxaspiro[4.5]decan-8-yl)carbamate is sourced from PubChem (CID 118666490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).