C16H22N4O2 — CID 118668773
N,N-diethyl-4-[(4R)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazin-3-yl]-2-nitroaniline (PubChem CID 118668773) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is N,N-diethyl-4-[(4R)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazin-3-yl]-2-nitroaniline.
| Compound Name | N,N-diethyl-4-[(4R)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazin-3-yl]-2-nitroaniline |
|---|---|
| PubChem CID | 118668773 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N,N-diethyl-4-[(4R)-4-methyl-6-methylidene-4,5-dihydro-1H-pyridazin-3-yl]-2-nitroaniline |
| SMILES | C=C1C[C@@H](C)C(c2ccc(N(CC)CC)c([N+](=O)[O-])c2)=NN1 |
| InChI | InChI=1S/C16H22N4O2/c1-5-19(6-2)14-8-7-13(10-15(14)20(21)22)16-11(3)9-12(4)17-18-16/h7-8,10-11,17H,4-6,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | MTHXTNRQDSMQEU-LLVKDONJSA-N |
| XLogP | 3.29 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|