C14H18N6O4S — CID 57214828
1-[2-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitroanilino]ethyl]-1-sulfanylurea (PubChem CID 57214828) has the molecular formula C14H18N6O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 1-[2-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitroanilino]ethyl]-1-sulfanylurea.
| Compound Name | 1-[2-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitroanilino]ethyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 57214828 |
| Molecular Formula | C14H18N6O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[2-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitroanilino]ethyl]-1-sulfanylurea |
| SMILES | CC1CC(=O)NN=C1c1ccc(NCCN(S)C(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N6O4S/c1-8-6-12(21)17-18-13(8)9-2-3-10(11(7-9)20(23)24)16-4-5-19(25)14(15)22/h2-3,7-8,16,25H,4-6H2,1H3,(H2,15,22)(H,17,21) |
| InChIKey | UKUHMDYBNRAMMK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|