C18H22N4O4 — CID 20516927
N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitrophenyl]cyclohexanecarboxamide (PubChem CID 20516927) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitrophenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitrophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 20516927 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-2-nitrophenyl]cyclohexanecarboxamide |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)C2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N4O4/c1-11-9-16(23)20-21-17(11)13-7-8-14(15(10-13)22(25)26)19-18(24)12-5-3-2-4-6-12/h7-8,10-12H,2-6,9H2,1H3,(H,19,24)(H,20,23) |
| InChIKey | MHOOLYDOOYSFBQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|