C14H19IN6O3S2 — CID 173370982
methyl N'-[2-[4-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-nitroanilino]ethyl]carbamimidothioate;hydroiodide (PubChem CID 173370982) has the molecular formula C14H19IN6O3S2 and a molecular weight of 510.38 g/mol. Its IUPAC name is methyl N'-[2-[4-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-nitroanilino]ethyl]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[2-[4-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-nitroanilino]ethyl]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 173370982 |
| Molecular Formula | C14H19IN6O3S2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | methyl N'-[2-[4-(6-methyl-2-oxo-3,6-dihydro-1,3,4-thiadiazin-5-yl)-2-nitroanilino]ethyl]carbamimidothioate;hydroiodide |
| SMILES | CS/C(N)=N\CCNc1ccc(C2=NNC(=O)SC2C)cc1[N+](=O)[O-].I |
| InChI | InChI=1S/C14H18N6O3S2.HI/c1-8-12(18-19-14(21)25-8)9-3-4-10(11(7-9)20(22)23)16-5-6-17-13(15)24-2;/h3-4,7-8,16H,5-6H2,1-2H3,(H2,15,17)(H,19,21);1H |
| InChIKey | BFMOUIYOEQXXHA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|