C14H18N4O3S — CID 59569027
6-methyl-5-[4-(2-methylpropylamino)-3-nitrophenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 59569027) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 6-methyl-5-[4-(2-methylpropylamino)-3-nitrophenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 6-methyl-5-[4-(2-methylpropylamino)-3-nitrophenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 59569027 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 6-methyl-5-[4-(2-methylpropylamino)-3-nitrophenyl]-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | CC(C)CNc1ccc(C2=NNC(=O)SC2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N4O3S/c1-8(2)7-15-11-5-4-10(6-12(11)18(20)21)13-9(3)22-14(19)17-16-13/h4-6,8-9,15H,7H2,1-3H3,(H,17,19) |
| InChIKey | REBGEVKCZVLUJO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|