About 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole
5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 118669257) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
Analyze 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole?
The IUPAC name of 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (CID 118669257) is 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
What is the SMILES notation for 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole?
The canonical SMILES for 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole is CCN1CC2COCC2C1.
What is the InChIKey of 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole?
The InChIKey is JMKLLDXXRALICA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-2-9-3-7-5-10-6-8(7)4-9/h7-8H,2-6H2,1H3.
What are the key properties of 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole?
5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole has a molecular weight of 141.21 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole is sourced from PubChem (CID 118669257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).