C6H3ClIN3 — CID 118669321
7-chloro-3-iodopyrazolo[1,5-a]pyrimidine (PubChem CID 118669321) has the molecular formula C6H3ClIN3 and a molecular weight of 279.47 g/mol. Its IUPAC name is 7-chloro-3-iodopyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-3-iodopyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 118669321 |
| Molecular Formula | C6H3ClIN3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 278.91 |
| IUPAC Name | 7-chloro-3-iodopyrazolo[1,5-a]pyrimidine |
| SMILES | Clc1ccnc2c(I)cnn12 |
| InChI | InChI=1S/C6H3ClIN3/c7-5-1-2-9-6-4(8)3-10-11(5)6/h1-3H |
| InChIKey | JBCMWZQGBAYVQW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|