About 1-chloro-4-iodo-2,6-naphthyridine
1-chloro-4-iodo-2,6-naphthyridine (PubChem CID 135397215) has the molecular formula C8H4ClIN2
and a molecular weight of 290.49 g/mol. Its IUPAC name is 1-chloro-4-iodo-2,6-naphthyridine.
Molecular Properties
| Compound Name | 1-chloro-4-iodo-2,6-naphthyridine |
| PubChem CID | 135397215 |
| Molecular Formula | C8H4ClIN2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 289.91 |
| IUPAC Name | 1-chloro-4-iodo-2,6-naphthyridine |
| SMILES | Clc1ncc(I)c2cnccc12 |
| InChI | InChI=1S/C8H4ClIN2/c9-8-5-1-2-11-3-6(5)7(10)4-12-8/h1-4H |
| InChIKey | WEGBWLBWEGRINM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-iodo-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-iodo-2,6-naphthyridine?
The IUPAC name of 1-chloro-4-iodo-2,6-naphthyridine (CID 135397215) is 1-chloro-4-iodo-2,6-naphthyridine.
What is the SMILES notation for 1-chloro-4-iodo-2,6-naphthyridine?
The canonical SMILES for 1-chloro-4-iodo-2,6-naphthyridine is Clc1ncc(I)c2cnccc12.
What is the InChIKey of 1-chloro-4-iodo-2,6-naphthyridine?
The InChIKey is WEGBWLBWEGRINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClIN2/c9-8-5-1-2-11-3-6(5)7(10)4-12-8/h1-4H.
What are the key properties of 1-chloro-4-iodo-2,6-naphthyridine?
1-chloro-4-iodo-2,6-naphthyridine has a molecular weight of 290.49 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-iodo-2,6-naphthyridine is sourced from PubChem (CID 135397215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).