About 4-chloro-1-methyl-2,6-naphthyridine
4-chloro-1-methyl-2,6-naphthyridine (PubChem CID 177329446) has the molecular formula C9H7ClN2
and a molecular weight of 178.62 g/mol. Its IUPAC name is 4-chloro-1-methyl-2,6-naphthyridine.
Molecular Properties
| Compound Name | 4-chloro-1-methyl-2,6-naphthyridine |
| PubChem CID | 177329446 |
| Molecular Formula | C9H7ClN2 |
| Molecular Weight | 178.62 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4-chloro-1-methyl-2,6-naphthyridine |
| SMILES | Cc1ncc(Cl)c2cnccc12 |
| InChI | InChI=1S/C9H7ClN2/c1-6-7-2-3-11-4-8(7)9(10)5-12-6/h2-5H,1H3 |
| InChIKey | KSVDNKSXUJOHDV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-1-methyl-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-methyl-2,6-naphthyridine?
The IUPAC name of 4-chloro-1-methyl-2,6-naphthyridine (CID 177329446) is 4-chloro-1-methyl-2,6-naphthyridine.
What is the SMILES notation for 4-chloro-1-methyl-2,6-naphthyridine?
The canonical SMILES for 4-chloro-1-methyl-2,6-naphthyridine is Cc1ncc(Cl)c2cnccc12.
What is the InChIKey of 4-chloro-1-methyl-2,6-naphthyridine?
The InChIKey is KSVDNKSXUJOHDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2/c1-6-7-2-3-11-4-8(7)9(10)5-12-6/h2-5H,1H3.
What are the key properties of 4-chloro-1-methyl-2,6-naphthyridine?
4-chloro-1-methyl-2,6-naphthyridine has a molecular weight of 178.62 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-methyl-2,6-naphthyridine is sourced from PubChem (CID 177329446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).