About 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine
1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine (PubChem CID 123656672) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine |
| PubChem CID | 123656672 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine |
| SMILES | Cc1nnc(C(C)C)c2cnccc12 |
| InChI | InChI=1S/C11H13N3/c1-7(2)11-10-6-12-5-4-9(10)8(3)13-14-11/h4-7H,1-3H3 |
| InChIKey | XCWWDTYEJPBSTC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine?
The IUPAC name of 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine (CID 123656672) is 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine.
What is the SMILES notation for 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine?
The canonical SMILES for 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine is Cc1nnc(C(C)C)c2cnccc12.
What is the InChIKey of 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine?
The InChIKey is XCWWDTYEJPBSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-7(2)11-10-6-12-5-4-9(10)8(3)13-14-11/h4-7H,1-3H3.
What are the key properties of 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine?
1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine has a molecular weight of 187.25 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylpyrido[3,4-d]pyridazine is sourced from PubChem (CID 123656672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).