C14H18N2 — CID 130377986
1,4-di(propan-2-yl)-2,6-naphthyridine (PubChem CID 130377986) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-2,6-naphthyridine.
| Compound Name | 1,4-di(propan-2-yl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 130377986 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1,4-di(propan-2-yl)-2,6-naphthyridine |
| SMILES | CC(C)c1cnc(C(C)C)c2ccncc12 |
| InChI | InChI=1S/C14H18N2/c1-9(2)12-8-16-14(10(3)4)11-5-6-15-7-13(11)12/h5-10H,1-4H3 |
| InChIKey | GCQYJWUIZNZYHZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |