About 4-chloropyrido[3,4-d]pyrimidine;hydrochloride
4-chloropyrido[3,4-d]pyrimidine;hydrochloride (PubChem CID 73012788) has the molecular formula C7H5Cl2N3
and a molecular weight of 202.04 g/mol. Its IUPAC name is 4-chloropyrido[3,4-d]pyrimidine;hydrochloride.
Molecular Properties
| Compound Name | 4-chloropyrido[3,4-d]pyrimidine;hydrochloride |
| PubChem CID | 73012788 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 4-chloropyrido[3,4-d]pyrimidine;hydrochloride |
| SMILES | Cl.Clc1ncnc2cnccc12 |
| InChI | InChI=1S/C7H4ClN3.ClH/c8-7-5-1-2-9-3-6(5)10-4-11-7;/h1-4H;1H |
| InChIKey | OUVRZLCXLNIFTI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloropyrido[3,4-d]pyrimidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrido[3,4-d]pyrimidine;hydrochloride?
The IUPAC name of 4-chloropyrido[3,4-d]pyrimidine;hydrochloride (CID 73012788) is 4-chloropyrido[3,4-d]pyrimidine;hydrochloride.
What is the SMILES notation for 4-chloropyrido[3,4-d]pyrimidine;hydrochloride?
The canonical SMILES for 4-chloropyrido[3,4-d]pyrimidine;hydrochloride is Cl.Clc1ncnc2cnccc12.
What is the InChIKey of 4-chloropyrido[3,4-d]pyrimidine;hydrochloride?
The InChIKey is OUVRZLCXLNIFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3.ClH/c8-7-5-1-2-9-3-6(5)10-4-11-7;/h1-4H;1H.
What are the key properties of 4-chloropyrido[3,4-d]pyrimidine;hydrochloride?
4-chloropyrido[3,4-d]pyrimidine;hydrochloride has a molecular weight of 202.04 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrido[3,4-d]pyrimidine;hydrochloride is sourced from PubChem (CID 73012788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).