C16H15FN2OS2 — CID 118670294
4-(5-fluoro-2-methylphenyl)-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione (PubChem CID 118670294) has the molecular formula C16H15FN2OS2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 4-(5-fluoro-2-methylphenyl)-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 4-(5-fluoro-2-methylphenyl)-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 118670294 |
| Molecular Formula | C16H15FN2OS2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 4-(5-fluoro-2-methylphenyl)-4-hydroxy-3-(pyridin-3-ylmethyl)-1,3-thiazolidine-2-thione |
| SMILES | Cc1ccc(F)cc1C1(O)CSC(=S)N1Cc1cccnc1 |
| InChI | InChI=1S/C16H15FN2OS2/c1-11-4-5-13(17)7-14(11)16(20)10-22-15(21)19(16)9-12-3-2-6-18-8-12/h2-8,20H,9-10H2,1H3 |
| InChIKey | QTLMDGAQFFQLHK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|