C22H28N2O3 — CID 11867330
(2S)-2-[(1R,2S)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 11867330) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is (2S)-2-[(1R,2S)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | (2S)-2-[(1R,2S)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 11867330 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (2S)-2-[(1R,2S)-1-hydroxy-7-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | COc1cc(C)c2c(c1C)[C@H](O)[C@H]([C@H](C)C(=O)NCc1cccnc1)CC2 |
| InChI | InChI=1S/C22H28N2O3/c1-13-10-19(27-4)15(3)20-17(13)7-8-18(21(20)25)14(2)22(26)24-12-16-6-5-9-23-11-16/h5-6,9-11,14,18,21,25H,7-8,12H2,1-4H3,(H,24,26)/t14-,18-,21+/m0/s1 |
| InChIKey | XZVNOPHFZHJSRL-DHUIEDIVSA-N |
| XLogP | 3.26 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |