C26H36N3O3+ — CID 11867349
(2S)-2-[(1R,2S)-1-hydroxy-5,8-dimethyl-7-(pyridin-3-ylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-1-(4-methylpiperazin-4-ium-1-yl)propan-1-one (PubChem CID 11867349) has the molecular formula C26H36N3O3+ and a molecular weight of 438.59 g/mol. Its IUPAC name is (2S)-2-[(1R,2S)-1-hydroxy-5,8-dimethyl-7-(pyridin-3-ylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-1-(4-methylpiperazin-4-ium-1-yl)propan-1-one.
| Compound Name | (2S)-2-[(1R,2S)-1-hydroxy-5,8-dimethyl-7-(pyridin-3-ylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-1-(4-methylpiperazin-4-ium-1-yl)propan-1-one |
|---|---|
| PubChem CID | 11867349 |
| Molecular Formula | C26H36N3O3+ |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (2S)-2-[(1R,2S)-1-hydroxy-5,8-dimethyl-7-(pyridin-3-ylmethoxy)-1,2,3,4-tetrahydronaphthalen-2-yl]-1-(4-methylpiperazin-4-ium-1-yl)propan-1-one |
| SMILES | Cc1cc(OCc2cccnc2)c(C)c2c1CC[C@@H]([C@H](C)C(=O)N1CC[NH+](C)CC1)[C@H]2O |
| InChI | InChI=1S/C26H35N3O3/c1-17-14-23(32-16-20-6-5-9-27-15-20)19(3)24-21(17)7-8-22(25(24)30)18(2)26(31)29-12-10-28(4)11-13-29/h5-6,9,14-15,18,22,25,30H,7-8,10-13,16H2,1-4H3/p+1/t18-,22-,25+/m0/s1 |
| InChIKey | DZFGLQMZNYWQDW-KDSXSNECSA-O |
| XLogP | 1.87 |
| TPSA | 67.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |