C25H24N4O2 — CID 118673755
1-methyl-N-[6-(4-oxo-3H-phthalazin-1-yl)spiro[3.3]heptan-2-yl]indole-6-carboxamide (PubChem CID 118673755) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-methyl-N-[6-(4-oxo-3H-phthalazin-1-yl)spiro[3.3]heptan-2-yl]indole-6-carboxamide.
| Compound Name | 1-methyl-N-[6-(4-oxo-3H-phthalazin-1-yl)spiro[3.3]heptan-2-yl]indole-6-carboxamide |
|---|---|
| PubChem CID | 118673755 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-methyl-N-[6-(4-oxo-3H-phthalazin-1-yl)spiro[3.3]heptan-2-yl]indole-6-carboxamide |
| SMILES | Cn1ccc2ccc(C(=O)NC3CC4(C3)CC(c3n[nH]c(=O)c5ccccc35)C4)cc21 |
| InChI | InChI=1S/C25H24N4O2/c1-29-9-8-15-6-7-16(10-21(15)29)23(30)26-18-13-25(14-18)11-17(12-25)22-19-4-2-3-5-20(19)24(31)28-27-22/h2-10,17-18H,11-14H2,1H3,(H,26,30)(H,28,31) |
| InChIKey | UTPSRQWFWVOECA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |