C26H27N5O3 — CID 134286708
3-methoxy-4-(1-methylpyrazol-4-yl)-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]benzamide (PubChem CID 134286708) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 3-methoxy-4-(1-methylpyrazol-4-yl)-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]benzamide.
| Compound Name | 3-methoxy-4-(1-methylpyrazol-4-yl)-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 134286708 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 3-methoxy-4-(1-methylpyrazol-4-yl)-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]benzamide |
| SMILES | COc1cc(C(=O)NC2CCC(c3n[nH]c(=O)c4ccccc34)CC2)ccc1-c1cnn(C)c1 |
| InChI | InChI=1S/C26H27N5O3/c1-31-15-18(14-27-31)20-12-9-17(13-23(20)34-2)25(32)28-19-10-7-16(8-11-19)24-21-5-3-4-6-22(21)26(33)30-29-24/h3-6,9,12-16,19H,7-8,10-11H2,1-2H3,(H,28,32)(H,30,33) |
| InChIKey | CDZYOTNCFMMLNU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |