C25H25N5O2 — CID 134286476
3-methyl-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-4-(1H-pyrazol-4-yl)benzamide (PubChem CID 134286476) has the molecular formula C25H25N5O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 3-methyl-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-4-(1H-pyrazol-4-yl)benzamide.
| Compound Name | 3-methyl-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-4-(1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 134286476 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-methyl-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-4-(1H-pyrazol-4-yl)benzamide |
| SMILES | Cc1cc(C(=O)NC2CCC(c3n[nH]c(=O)c4ccccc34)CC2)ccc1-c1cn[nH]c1 |
| InChI | InChI=1S/C25H25N5O2/c1-15-12-17(8-11-20(15)18-13-26-27-14-18)24(31)28-19-9-6-16(7-10-19)23-21-4-2-3-5-22(21)25(32)30-29-23/h2-5,8,11-14,16,19H,6-7,9-10H2,1H3,(H,26,27)(H,28,31)(H,30,32) |
| InChIKey | WTURGQMWWRSMKP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |