C23H20ClN3O2S — CID 134286552
6-chloro-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-1-benzothiophene-2-carboxamide (PubChem CID 134286552) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 6-chloro-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 6-chloro-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 134286552 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 6-chloro-N-[4-(4-oxo-3H-phthalazin-1-yl)cyclohexyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCC(c2n[nH]c(=O)c3ccccc23)CC1)c1cc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C23H20ClN3O2S/c24-15-8-5-14-11-20(30-19(14)12-15)23(29)25-16-9-6-13(7-10-16)21-17-3-1-2-4-18(17)22(28)27-26-21/h1-5,8,11-13,16H,6-7,9-10H2,(H,25,29)(H,27,28) |
| InChIKey | JIFVBXWPLMTEHN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |