C10H8F11N — CID 118673891
1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine (PubChem CID 118673891) has the molecular formula C10H8F11N and a molecular weight of 351.16 g/mol. Its IUPAC name is 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 118673891 |
| Molecular Formula | C10H8F11N |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-[(E)-1,2,3,3,3-pentafluoroprop-1-enyl]-3,5-bis(trifluoromethyl)piperidine |
| SMILES | F/C(=C(/F)C(F)(F)F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H8F11N/c11-6(10(19,20)21)7(12)22-2-4(8(13,14)15)1-5(3-22)9(16,17)18/h4-5H,1-3H2/b7-6- |
| InChIKey | CGAQELFAMNGIDC-SREVYHEPSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|