C21H22N4O3 — CID 11867422
(4aS,7aR)-5-[4-(dimethylamino)benzoyl]-3-phenyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 11867422) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is (4aS,7aR)-5-[4-(dimethylamino)benzoyl]-3-phenyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aS,7aR)-5-[4-(dimethylamino)benzoyl]-3-phenyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11867422 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4aS,7aR)-5-[4-(dimethylamino)benzoyl]-3-phenyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CN(C)c1ccc(C(=O)N2CC[C@H]3NC(=O)N(c4ccccc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C21H22N4O3/c1-23(2)15-10-8-14(9-11-15)19(26)24-13-12-17-18(24)20(27)25(21(28)22-17)16-6-4-3-5-7-16/h3-11,17-18H,12-13H2,1-2H3,(H,22,28)/t17-,18+/m1/s1 |
| InChIKey | CUZFAJWLPKXMPM-MSOLQXFVSA-N |
| XLogP | 2.09 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |