C17H20FN3O3 — CID 73135287
5-(2,2-dimethylpropanoyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 73135287) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-(2,2-dimethylpropanoyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 5-(2,2-dimethylpropanoyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 73135287 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(2,2-dimethylpropanoyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)N1CCC2NC(=O)N(c3ccc(F)cc3)C(=O)C21 |
| InChI | InChI=1S/C17H20FN3O3/c1-17(2,3)15(23)20-9-8-12-13(20)14(22)21(16(24)19-12)11-6-4-10(18)5-7-11/h4-7,12-13H,8-9H2,1-3H3,(H,19,24) |
| InChIKey | CSBUSEILJDZVLW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |