C18H20FN3O3 — CID 163136175
(4aR,7aR)-5-(cyclopentanecarbonyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 163136175) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is (4aR,7aR)-5-(cyclopentanecarbonyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | (4aR,7aR)-5-(cyclopentanecarbonyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163136175 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (4aR,7aR)-5-(cyclopentanecarbonyl)-3-(4-fluorophenyl)-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1N[C@@H]2CCN(C(=O)C3CCCC3)[C@H]2C(=O)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FN3O3/c19-12-5-7-13(8-6-12)22-17(24)15-14(20-18(22)25)9-10-21(15)16(23)11-3-1-2-4-11/h5-8,11,14-15H,1-4,9-10H2,(H,20,25)/t14-,15-/m1/s1 |
| InChIKey | IANCHONYKPCMII-HUUCEWRRSA-N |
| XLogP | 2.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |