C17H19N3O6 — CID 78452131
2-[2-[3-(4-methylphenyl)-2,4-dioxo-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetic acid (PubChem CID 78452131) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-[2-[3-(4-methylphenyl)-2,4-dioxo-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[3-(4-methylphenyl)-2,4-dioxo-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 78452131 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[2-[3-(4-methylphenyl)-2,4-dioxo-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidin-5-yl]-2-oxoethoxy]acetic acid |
| SMILES | Cc1ccc(N2C(=O)NC3CCN(C(=O)COCC(=O)O)C3C2=O)cc1 |
| InChI | InChI=1S/C17H19N3O6/c1-10-2-4-11(5-3-10)20-16(24)15-12(18-17(20)25)6-7-19(15)13(21)8-26-9-14(22)23/h2-5,12,15H,6-9H2,1H3,(H,18,25)(H,22,23) |
| InChIKey | KTLMVSPFQZJNBE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |