C28H31FN4O3S — CID 118678071
1-[[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indole (PubChem CID 118678071) has the molecular formula C28H31FN4O3S and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-[[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indole.
| Compound Name | 1-[[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indole |
|---|---|
| PubChem CID | 118678071 |
| Molecular Formula | C28H31FN4O3S |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | 1-[[1-(2-fluorophenyl)sulfonylpiperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indole |
| SMILES | O=S(=O)(c1ccccc1F)N1CCC(Cn2ccc3cc(-c4cnn(C5CCCCO5)c4)ccc32)CC1 |
| InChI | InChI=1S/C28H31FN4O3S/c29-25-5-1-2-6-27(25)37(34,35)32-14-10-21(11-15-32)19-31-13-12-23-17-22(8-9-26(23)31)24-18-30-33(20-24)28-7-3-4-16-36-28/h1-2,5-6,8-9,12-13,17-18,20-21,28H,3-4,7,10-11,14-16,19H2 |
| InChIKey | YLIJFDYIEYSPSM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |