C27H31N5O3S — CID 118674568
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indazole (PubChem CID 118674568) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indazole.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indazole |
|---|---|
| PubChem CID | 118674568 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-5-[1-(oxan-2-yl)pyrazol-4-yl]indazole |
| SMILES | O=S(=O)(c1ccccc1)N1CCC(Cn2ncc3cc(-c4cnn(C5CCCCO5)c4)ccc32)CC1 |
| InChI | InChI=1S/C27H31N5O3S/c33-36(34,25-6-2-1-3-7-25)30-13-11-21(12-14-30)19-31-26-10-9-22(16-23(26)17-28-31)24-18-29-32(20-24)27-8-4-5-15-35-27/h1-3,6-7,9-10,16-18,20-21,27H,4-5,8,11-15,19H2 |
| InChIKey | FUUHVDCUZARMPC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |