C24H25IN5OP — CID 129197351
1-[4-[[5-(1-iodophosphanylpyrazol-4-yl)indazol-1-yl]methyl]piperidin-1-yl]-2-phenylethanone (PubChem CID 129197351) has the molecular formula C24H25IN5OP and a molecular weight of 557.38 g/mol. Its IUPAC name is 1-[4-[[5-(1-iodophosphanylpyrazol-4-yl)indazol-1-yl]methyl]piperidin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[[5-(1-iodophosphanylpyrazol-4-yl)indazol-1-yl]methyl]piperidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 129197351 |
| Molecular Formula | C24H25IN5OP |
| Molecular Weight | 557.38 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | 1-[4-[[5-(1-iodophosphanylpyrazol-4-yl)indazol-1-yl]methyl]piperidin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCC(Cn2ncc3cc(-c4cnn(PI)c4)ccc32)CC1 |
| InChI | InChI=1S/C24H25IN5OP/c25-32-30-17-22(15-27-30)20-6-7-23-21(13-20)14-26-29(23)16-19-8-10-28(11-9-19)24(31)12-18-4-2-1-3-5-18/h1-7,13-15,17,19,32H,8-12,16H2 |
| InChIKey | HUTOZCYHNHCQPU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.38 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|