C23H25IN5O2PS — CID 129197453
[4-[1-[(1-benzylsulfonylpiperidin-4-yl)methyl]indazol-5-yl]pyrazol-1-yl]-iodophosphane (PubChem CID 129197453) has the molecular formula C23H25IN5O2PS and a molecular weight of 593.43 g/mol. Its IUPAC name is [4-[1-[(1-benzylsulfonylpiperidin-4-yl)methyl]indazol-5-yl]pyrazol-1-yl]-iodophosphane.
| Compound Name | [4-[1-[(1-benzylsulfonylpiperidin-4-yl)methyl]indazol-5-yl]pyrazol-1-yl]-iodophosphane |
|---|---|
| PubChem CID | 129197453 |
| Molecular Formula | C23H25IN5O2PS |
| Molecular Weight | 593.43 g/mol |
| Exact Mass | 593.05 |
| IUPAC Name | [4-[1-[(1-benzylsulfonylpiperidin-4-yl)methyl]indazol-5-yl]pyrazol-1-yl]-iodophosphane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC(Cn2ncc3cc(-c4cnn(PI)c4)ccc32)CC1 |
| InChI | InChI=1S/C23H25IN5O2PS/c24-32-29-16-22(14-26-29)20-6-7-23-21(12-20)13-25-28(23)15-18-8-10-27(11-9-18)33(30,31)17-19-4-2-1-3-5-19/h1-7,12-14,16,18,32H,8-11,15,17H2 |
| InChIKey | NSDUREKNLWWPLR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|