C22H19Cl2N3O3S — CID 170427028
1-(benzenesulfonyl)-6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]indole (PubChem CID 170427028) has the molecular formula C22H19Cl2N3O3S and a molecular weight of 476.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]indole.
| Compound Name | 1-(benzenesulfonyl)-6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]indole |
|---|---|
| PubChem CID | 170427028 |
| Molecular Formula | C22H19Cl2N3O3S |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 475.05 |
| IUPAC Name | 1-(benzenesulfonyl)-6,7-dichloro-3-[1-(oxan-2-yl)pyrazol-4-yl]indole |
| SMILES | O=S(=O)(c1ccccc1)n1cc(-c2cnn(C3CCCCO3)c2)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C22H19Cl2N3O3S/c23-19-10-9-17-18(15-12-25-26(13-15)20-8-4-5-11-30-20)14-27(22(17)21(19)24)31(28,29)16-6-2-1-3-7-16/h1-3,6-7,9-10,12-14,20H,4-5,8,11H2 |
| InChIKey | FWYGSFXXWDARMI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |